Welcome: Chemsynlab ,carbohydrate chemistry
Language: Chinese ∷  English

802590-64-3,Myo-inositol trispyrophosphate,CAS:802590-64-3

802590-64-3,
Myo-inositol trispyrophosphate,
CAS:802590-64-3
C6H12O21P6 / 605.99

三焦磷酸肌醇,Myo-inositol trispyrophosphate

Myo-inositol trispyrophosphate (ITPP, cas 802590-64-3) is a novel allosteric effector of haemoglobin with high permeation selectivity across the red blood cell plasma membrane. Due to its potential to reduce the oxygen affinity of haemoglobin, ITPP application results in an enhanced oxygen release in hypoxic tissues. Therefore, ITPP is being examined for the treatment of numerous illnesses that involve hypoxia, such as cardiovascular diseases, cancer or Alzheimer/'s disease.

Myo-inositol trispyrophosphate (IP3) is a natural compound that is known to be involved in the regulation of cell proliferation and differentiation. IP3 has been shown to induce tumor formation in experimental models. The action of IP3 is mediated by its binding to a protein called InsP3 receptor, which activates phospholipase C, leading to increased levels of intracellular calcium ions. The increase in calcium ions leads to a series of reactions that ultimately result in the activation of tumor-promoting genes, such as mucin gene and angiogenic process. This compound also stimulates carcinoma cell lines in vitro and induces tumor formation in vivo.


CAS Number802590-64-3
Product NameMyo-inositol trispyrophosphate
IUPAC Name4,6,11,13,18,20-hexahydroxy-3,5,7,10,12,14,17,19,21-nonaoxa-4λ5,6λ5,11λ5,13λ5,18λ5,20λ5-hexaphosphatetracyclo[14.5.0.02,8.09,15]henicosane 4,6,11,13,18,20-hexaoxide
Molecular FormulaC6H12O21P6
Molecular Weight605.99 g/mol
InChIInChI=1S/C6H12O21P6/c7-28(8)19-1-2(20-29(9,10)25-28)4-6(24-33(17,18)27-32(15,16)23-4)5-3(1)21-30(11,12)26-31(13,14)22-5/h1-6H,(H,7,8)(H,9,10)(H,11,12)(H,13,14)(H,15,16)(H,17,18)
InChI KeyHEDKSUBRULAYNO-UHFFFAOYSA-N
SMILESC12C(C3C(C4C1OP(=O)(OP(=O)(O4)O)O)OP(=O)(OP(=O)(O3)O)O)OP(=O)(OP(=O)(O2)O)O
Synonymsinositol trispyrophosphate, ITPP cpd, myo-inositol trispyrophosphate
Canonical SMILESC12C(C3C(C4C1OP(=O)(OP(=O)(O4)O)O)OP(=O)(OP(=O)(O3)O)O)OP(=O)(OP(=O)(O2)O)O


INQUIRY

Scan the qr codeClose
the qr code