18265-46-8 ,D-Ribose-5-phosphate disodium salt hydrate,
CAS:18265-46-8
C5H9Na2O8P·2H2O / 310.1
MFCD00149349
Precursor for the synthesis of nucleotides.
| CAS Number | 18265-46-8 |
| Product Name | (2R,3R,4R)-2,3,4-Trihydroxy-5-oxopentyl dihydrogen phosphate, disodium salt |
| IUPAC Name | disodium;(2R,3S,4R)-4-hydroxy-1-oxo-5-phosphonooxypentane-2,3-diolate |
| Molecular Formula | C5H9Na2O8P |
| Molecular Weight | 274.07 g/mol |
| InChI | InChI=1S/C5H9O8P.2Na/c6-1-3(7)5(9)4(8)2-13-14(10,11)12;;/h1,3-5,8H,2H2,(H2,10,11,12);;/q-2;2*+1/t3-,4+,5-;;/m0../s1 |
| InChI Key | MSUSOPCULOEKKB-LMQMBFIUSA-L |
| SMILES | C(C(C(C(C=O)[O-])[O-])O)OP(=O)(O)O.[Na+].[Na+] |
| Canonical SMILES | C(C(C(C(C=O)O)O)O)OP(=O)([O-])[O-].[Na+].[Na+] |
| Isomeric SMILES | C([C@H]([C@H]([C@H](C=O)O)O)O)OP(=O)([O-])[O-].[Na+].[Na+] |
| CAS No: 207671-46-3,3615-55-2,18265-46-8 MDL No: MFCD00149349 Chemical Formula: C5H9Na2O8P·2H2O Molecular Weight: 310.1 |
| References: 1. Kolb VM, Dworkin JP, Miller SL, J. Mol. Evolution 1994, Vol38, No6, p549-557 |
Contact: Mr.Li
Phone: 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628