6763-34-4 , a-D-Xylopyranose,
CAS:6763-34-4
C5H10O5 / 150.13
D-Xylopyranose is a sugar with the chemical formula C5H10O5. It is a potent antagonist of sweet taste, which may be due to its ability to bind to the sweet receptor on the tongue. D-Xylopyranose can also be used as an analytical reagent in analytical chemistry and has been shown to have anti-inflammatory properties. D-Xylopyranose can be hydrolyzed by acid or base into two molecules of l-arabinose and one molecule of water, and is composed of five carbon atoms, 10 hydrogen atoms, one oxygen atom, and one hydroxyl group. The structure of D-xylopyranose contains a terminal residue (e.g., l-arabinose) that can form glycosidic bonds with other sugars such as glucose or sucrose to form disaccharides such as maltose or sucrose.
CAS Number | 6763-34-4 |
Product Name | Alpha-d-xylopyranose |
IUPAC Name | (2S,3R,4S,5R)-oxane-2,3,4,5-tetrol |
Molecular Formula | C5H10O5 |
Molecular Weight | 150.13 g/mol |
InChI | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5+/m1/s1 |
InChI Key | SRBFZHDQGSBBOR-LECHCGJUSA-N |
SMILES | C1C(C(C(C(O1)O)O)O)O |
Canonical SMILES | C1C(C(C(C(O1)O)O)O)O |
Isomeric SMILES | C1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O |
Contact: Miss.Xing
Phone: 18310328607 , 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628