Welcome: Chemsynlab ,carbohydrate chemistry
Language: Chinese ∷  English

6763-34-4, a-D-Xylopyranose, CAS:6763-34-4

6763-34-4 , a-D-Xylopyranose,
CAS:6763-34-4
C5H10O5 / 150.13

a-D-吡喃木糖, a-D-Xylopyranose

D-Xylopyranose is a sugar with the chemical formula C5H10O5. It is a potent antagonist of sweet taste, which may be due to its ability to bind to the sweet receptor on the tongue. D-Xylopyranose can also be used as an analytical reagent in analytical chemistry and has been shown to have anti-inflammatory properties. D-Xylopyranose can be hydrolyzed by acid or base into two molecules of l-arabinose and one molecule of water, and is composed of five carbon atoms, 10 hydrogen atoms, one oxygen atom, and one hydroxyl group. The structure of D-xylopyranose contains a terminal residue (e.g., l-arabinose) that can form glycosidic bonds with other sugars such as glucose or sucrose to form disaccharides such as maltose or sucrose.

CAS Number6763-34-4
Product NameAlpha-d-xylopyranose
IUPAC Name(2S,3R,4S,5R)-oxane-2,3,4,5-tetrol
Molecular FormulaC5H10O5
Molecular Weight150.13 g/mol
InChIInChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5+/m1/s1
InChI KeySRBFZHDQGSBBOR-LECHCGJUSA-N
SMILESC1C(C(C(C(O1)O)O)O)O
Canonical SMILESC1C(C(C(C(O1)O)O)O)O
Isomeric SMILESC1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O


INQUIRY

Scan the qr codeClose
the qr code