6490-70-6 , 2-Amino-2-deoxy-a-D-glucose,a-D-Glucosamine,
CAS:6490-70-6
C6H13NO5 / 179.17
Alpha-D-glucosamine is a 2-amino-2-deoxy-D-glucopyranose with an alpha-configuration at the anomeric position. It derives from an alpha-D-glucose.
| CAS Number | 6490-70-6 |
| Product Name | 2-amino-2-deoxy-alpha-D-glucopyranose |
| IUPAC Name | (2S,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol |
| Molecular Formula | C6H13NO5 |
| Molecular Weight | 179.17 g/mol |
| InChI | InChI=1S/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6+/m1/s1 |
| InChI Key | MSWZFWKMSRAUBD-UKFBFLRUSA-N |
| SMILES | C(C1C(C(C(C(O1)O)N)O)O)O |
| Canonical SMILES | C(C1C(C(C(C(O1)O)N)O)O)O |
| Isomeric SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)N)O)O)O |
Contact: Mr.Li
Phone: 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628