5934-56-5, L-idose,CAS: 5934-56-5
C6H12O6 / 180.16
MFCD00069825
L-Idose is an aqueous solution of dextrose and anhydrous dextrose. It is a carbohydrate that provides energy to the body. L-Idose can be used to minimize the effects of certain organisms, such as bacteria, yeast, and fungi. It also helps to maintain blood glucose levels in people with diabetes by providing a source of glucose for their metabolism. L-Idose can be found in fruits and other foods that contain carbohydrates, such as breads, cereals, pastas, rice, potatoes, pasta sauces, chips, and crackers.
| CAS Number | 5934-56-5 |
| Product Name | Idose, L- |
| IUPAC Name | (2R,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexanal |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 g/mol |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4-,5+,6+/m0/s1 |
| InChI Key | GZCGUPFRVQAUEE-UNTFVMJOSA-N |
| SMILES | C(C(C(C(C(C=O)O)O)O)O)O |
| Canonical SMILES | C(C(C(C(C(C=O)O)O)O)O)O |
| Isomeric SMILES | C([C@@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)O |
| CAS No: 5934-56-5 MDL No: MFCD00069825 Chemical Formula: C6H12O6 Molecular Weight: 180.16 |
| References: 1. Adinolfi M, Barone G, de Lorenzo F, Ladonisi A, Synlett 1999, 336-338 |
Contact: Mr.Li
Phone: 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628