Welcome: Chemsynlab ,carbohydrate chemistry
Language: Chinese ∷  English

5934-56-5, L-idose, CAS:5934-56-5

5934-56-5, L-idose,CAS: 5934-56-5
C6H12O6 / 180.16
MFCD00069825

L-idose,L-艾杜糖

L-Idose is an aqueous solution of dextrose and anhydrous dextrose. It is a carbohydrate that provides energy to the body. L-Idose can be used to minimize the effects of certain organisms, such as bacteria, yeast, and fungi. It also helps to maintain blood glucose levels in people with diabetes by providing a source of glucose for their metabolism. L-Idose can be found in fruits and other foods that contain carbohydrates, such as breads, cereals, pastas, rice, potatoes, pasta sauces, chips, and crackers.

CAS Number5934-56-5
Product NameIdose, L-
IUPAC Name(2R,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexanal
Molecular FormulaC6H12O6
Molecular Weight180.16 g/mol
InChIInChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4-,5+,6+/m0/s1
InChI KeyGZCGUPFRVQAUEE-UNTFVMJOSA-N
SMILESC(C(C(C(C(C=O)O)O)O)O)O
Canonical SMILESC(C(C(C(C(C=O)O)O)O)O)O
Isomeric SMILESC([C@@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)O
CAS No: 5934-56-5 MDL No: MFCD00069825 Chemical Formula: C6H12O6 Molecular Weight: 180.16
References: 1. Adinolfi M, Barone G, de Lorenzo F, Ladonisi A, Synlett 1999, 336-338


INQUIRY

Scan the qr codeClose
the qr code