76-54-0, 2,7-Dichlorofluorescein;
2',7'-Dichloro-3',6'-dihydroxyspiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one; 2',7'-Dichloro-3,6-fluorandiol
Cas:76-54-0
C20H10Cl2O5 / 401.20
MFCD00005047
2',7'-Dichloro-3',6'-dihydroxyspiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one; 2',7'-Dichloro-3,6-fluorandiol
Fluorophore used in biological assays and for labeling cells and tissues.
2',7'-Dichlorofluorescein (DCF) is a fluorescent dye that is commonly used to measure reactive oxygen species (ROS), which are important in various biological processes. DCF is an analog of fluorescein and contains two chlorine atoms located at the 2' and 7' positions. The presence of these chlorine atoms makes DCF much less polar than fluorescein, making it more lipophilic and readily able to penetrate cell membranes. DCF has been widely used in various scientific applications, including biological research, environmental monitoring, and materials science.
CAS Number | 76-54-0 |
Product Name | 2',7'-Dichlorofluorescein |
IUPAC Name | 2',7'-dichloro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
Molecular Formula | C20H10Cl2O5 |
Molecular Weight | 401.2 g/mol |
InChI | InChI=1S/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H |
InChI Key | VFNKZQNIXUFLBC-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C=C4OC5=CC(=C(C=C35)Cl)O)O)Cl |
Synonyms | 2’,7’-Dichlorofluorescein; 2’,7’-Dichlorofluoresceine; D and C Orange 25; D and C Orange No. 25; Dichlorofluorescein; Fluorescein 27; Fluorescein 548 |
Canonical SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C=C4OC5=CC(=C(C=C35)Cl)O)O)Cl |
Contact: Miss.Xing
Phone: 18310328607 , 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628