Cas:682802-80-8 ,
5-Bromo-6-chloro-3-indoxyl nonanoate ,
Magenta(tm)-nonanoate
C17H21BrClNO2 / 386.71
MFCD02683901
5-Bromo-6-chloro-3-indoxyl nonanoate is a chemical compound that is used in the detection of bioluminescence. It is a substrate for enzymes, such as luciferase, and can be used to measure the amount of light emitted during the reaction.
| CAS Number | 682802-80-8 |
| Product Name | 5-Bromo-6-chloro-3-indolyl nonanoate |
| IUPAC Name | (5-bromo-6-chloro-1H-indol-3-yl) nonanoate |
| Molecular Formula | C17H21BrClNO2 |
| Molecular Weight | 386.7 g/mol |
| InChI | InChI=1S/C17H21BrClNO2/c1-2-3-4-5-6-7-8-17(21)22-16-11-20-15-10-14(19)13(18)9-12(15)16/h9-11,20H,2-8H2,1H3 |
| InChI Key | IDBLIPXDRLAWIR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)OC1=CNC2=CC(=C(C=C21)Br)Cl |
| Canonical SMILES | CCCCCCCCC(=O)OC1=CNC2=CC(=C(C=C21)Br)Cl |
Contact: Mr.Li
Phone: 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628