56253-32-8 ,Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside,
CAS:56253-32-8
C28H26O8 / 490.5
MFCD04038162
甲基-2,3-O-二苯甲酰基-4,6-O-苄叉-beta-D-吡喃葡萄糖苷,
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside, also known as MDBGN, is a synthetic compound that has gained significant interest in the scientific community due to its various biological and commercial properties. MDBGN belongs to the benzylidene class and has the molecular formula C28H26O8. In this paper, we will discuss the definition and background, physical and chemical properties, synthesis, characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, and limitations and future directions of MDBGN.
Definition and Background
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside is a synthetic chemical compound that belongs to the benzylidene class of compounds. In 1963, it was first synthesized by Mukaiyama et al. by the reaction of benzaldehyde with methyl 2,3-di-O-benzoyl-b-D-glucopyranoside. Since then, Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside has gained significant attention due to its potential use in various fields, including medicine, agriculture, and food industries.
Synthesis and Characterization
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside can be synthesized by reacting benzaldehyde with methyl 2,3-di-O-benzoyl-b-D-glucopyranoside in the presence of a weak organic base such as triethylamine. The reaction yields Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside as a yellowish solid. The synthesis can be optimized by varying the reaction conditions such as temperature, solvent, and concentration. The optimization improves the yield, purity, and reproducibility of the method.
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside can be characterized by various techniques such as nuclear magnetic resonance (NMR), infrared spectroscopy (IR), and mass spectrometry (MS). NMR provides information on the structural properties of the compound, while IR provides information on the functional groups present in the compound. MS provides information on the molecular weight and fragmentation patterns of the compound.
Analytical Methods
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside can be quantified by various methods such as high-performance liquid chromatography (HPLC) and gas chromatography-mass spectrometry (GC-MS). HPLC is a commonly used technique for the analysis of Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside due to its sensitivity and specificity. GC-MS is also a powerful technique that allows for the identification, quantification, and characterization of Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside.
Biological Properties
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside exhibits various biological properties, including anti-inflammatory, anticancer, and antimicrobial activities. It has been shown to inhibit the growth of cancer cells in vitro, particularly breast and colon cancer cells. Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside also demonstrates antimicrobial activities against various microorganisms such as bacteria and fungi.
Toxicity and Safety in Scientific Experiments
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside exhibits low toxicity and is considered safe for use in scientific experiments when administered in the recommended doses. However, the exact toxicity and safety profiles of Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside are not well established, and further studies are needed to evaluate its long-term effects.
Applications in Scientific Experiments
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside has several applications in scientific experiments, particularly in the fields of medicine, agriculture, and food industry. In medicine, it has potential use as an anticancer agent, anti-inflammatory agent, and drug delivery agent. In agriculture, it can be used to enhance plant growth and improve crop yield, while in the food industry, it can be used as a food preservative and antioxidant.
Current State of Research
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside is actively being researched due to its potential in various fields, as well as its unique physical and chemical properties. Researchers are exploring the compound's potential in drug development, as well as its applications in agriculture and food industries.
Potential Implications in Various Fields of Research and Industry
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside has significant potential in various fields of research and industry. In medicine, it has potential as an anticancer agent, anti-inflammatory agent, and drug delivery agent. In agriculture, it can be used to enhance plant growth and improve crop yield, while in the food industry, it can be used as a food preservative and antioxidant.
Limitations and Future Directions
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside has several limitations that hinder its widespread use in various fields. These include its low solubility in water, high cost of synthesis, and lack of well-established toxicity profiles. Future research can focus on overcoming these limitations by developing more efficient and cost-effective synthetic routes, improving the compound's solubility, and conducting more comprehensive toxicity studies. Additionally, more research is needed to explore the potential of Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside in various fields, as well as to identify new applications and potential uses of the compound.
Future Directions include:
1. Development of more efficient and cost-effective synthetic routes
2. Improving the compound's solubility in water
3. Conducting more comprehensive toxicity studies
4. Identifying new applications and potential uses of the compound
5. Investigating the potential of Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside in drug development and delivery
6. Exploring the use of Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside as a food preservative and antioxidant
7. Developing new analytical methods for the quantification and characterization of Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside
8. Investigating the molecular mechanisms underlying the biological properties of Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside
9. Conducting more in vivo studies to evaluate the pharmacokinetics and pharmacodynamics of the compound
10. Examining the potential of Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside in sustainable agriculture practices.
Conclusion
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside is a synthetic compound belonging to the benzylidene class that exhibits various biological and commercial properties. It has potential use as an anticancer agent, anti-inflammatory agent, and drug delivery agent in medicine, and as a plant growth enhancer and food preservative in agriculture and food industries. Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside has several limitations that hinder its widespread use in various fields, and further research is needed to explore its full potential and overcome these limitations. Overall, Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside is an interesting compound with several potential applications in various fields, and its research is a promising area for future endeavors.
CAS Number | 56253-32-8 |
Product Name | Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-glucopyranoside |
IUPAC Name | [(4aR,6R,7R,8S,8aR)-7-benzoyloxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate |
Molecular Formula | C28H26O8 |
Molecular Weight | 490.5 g/mol |
InChI | InChI=1S/C28H26O8/c1-31-28-24(35-26(30)19-13-7-3-8-14-19)23(34-25(29)18-11-5-2-6-12-18)22-21(33-28)17-32-27(36-22)20-15-9-4-10-16-20/h2-16,21-24,27-28H,17H2,1H3/t21-,22-,23+,24-,27?,28-/m1/s1 |
InChI Key | CGMUHSNJRXPSSA-IAXIUWOKSA-N |
SMILES | COC1C(C(C2C(O1)COC(O2)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
Canonical SMILES | COC1C(C(C2C(O1)COC(O2)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
Isomeric SMILES | CO[C@H]1[C@@H]([C@H]([C@H]2[C@H](O1)COC(O2)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
CAS No: 56253-32-8 MDL No: MFCD04038162 Chemical Formula: C28H26O8 Molecular Weight: 490.5 |
Contact: Miss.Xing
Phone: 18310328607 , 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628