54623-25-5 , 2,3,5-tri-O-benzyl-alpha-d-ribofuranose,
CAS: 54623-25-5
C26H28O5 / 420.5
MFCD03425640
2,3,5-三苄基-D-呋喃核糖,
Remdesivir impurity.
2,3,5-Tri-O-benzyl-D-ribose is a chemical compound that has gained significant importance in scientific research and industry. This compound possesses a unique skeleton of carbohydrates that contributes to its characteristic properties. In this paper, we aim to provide a comprehensive review of the definition, physical and chemical properties, synthesis, characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions of 2,3,5-Tri-O-benzyl-D-ribose.
| CAS Number | 54623-25-5 |
| Product Name | 2,3,5-Tri-O-benzyl-D-ribose |
| IUPAC Name | (2R,3R,4R)-4-hydroxy-2,3,5-tris(phenylmethoxy)pentanal |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.5 g/mol |
| InChI | InChI=1S/C26H28O5/c27-16-25(30-18-22-12-6-2-7-13-22)26(31-19-23-14-8-3-9-15-23)24(28)20-29-17-21-10-4-1-5-11-21/h1-16,24-26,28H,17-20H2/t24-,25+,26-/m1/s1 |
| InChI Key | XUCNSIRQCBFBHF-UODIDJSMSA-N |
| SMILES | C1=CC=C(C=C1)COCC(C(C(C=O)OCC2=CC=CC=C2)OCC3=CC=CC=C3)O |
| Synonyms | 2,3,5-tri-O-benzyl-d-ribose |
| Canonical SMILES | C1=CC=C(C=C1)COCC(C(C(C=O)OCC2=CC=CC=C2)OCC3=CC=CC=C3)O |
| Isomeric SMILES | C1=CC=C(C=C1)COC[C@H]([C@H]([C@H](C=O)OCC2=CC=CC=C2)OCC3=CC=CC=C3)O |
| CAS No: 54623-25-5 Synonyms: 2,3,5-Tri-O-benzyl-D-ribofuranose MDL No: MFCD03425640 Chemical Formula: C26H28O5 Molecular Weight: 420.5 |
| References: 1. Su TL, Klein RS, Fox JJ, J. Org. Chem. 1982, Vol47, p1506-1509 |
Contact: Mr.Li
Phone: 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628