Welcome: Chemsynlab ,carbohydrate chemistry
Language: Chinese ∷  English

383417-46-7 , Fuc-a-1-2-Gal-a-PNP; 4-Nitrophenyl 2-O-(a-L-fucopyranosyl)-a-D-galactopyranoside

383417-46-7 , Fuc-a-1-2-Gal-a-PNP;
4-Nitrophenyl 2-O-(a-L-fucopyranosyl)-a-D-galactopyranoside
Cas:383417-46-7
C18H25NO12 / 447.39
MFCD01863437

4-Nitrophenyl 2-O-(a-L-fucopyranosyl)-a-D-galactopyranoside

Fuc-a-1-2-Gal-a-PNP

4-Nitrophenyl 2-O-(a-L-fucopyranosyl)-a-D-galactopyranoside is a chromogenic pNP enzyme substrate consisting of a fucose and galactose moieties. Upon enzymatic hydrolysis by specific fucosidases or galactosidases, it releases the highly chromogenic molecule 4-nitrophenol, which exhibits a distinct yellow color that can be monitored spectrophotometrically. This substrate is frequently used to study enzyme specificity, kinetics, and inhibition, and it plays a critical role in the investigation of carbohydrate active enzymes (CAZymes), the screening of enzyme inhibitors, and the development of novel analytical methods for the detection and quantitation of enzyme activities.

CAS Number383417-46-7
Product Name4-Nitrophenyl 2-O-(a-L-fucopyranosyl)-a-D-galactopyranoside
IUPAC Name(2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-(4-nitrophenoxy)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Molecular FormulaC₁₈H₂₅NO₁₂
Molecular Weight447.39
InChIInChI=1S/C18H25NO12/c1-7-11(21)13(23)15(25)17(28-7)31-16-14(24)12(22)10(6-20)30-18(16)29-9-4-2-8(3-5-9)19(26)27/h2-5,7,10-18,20-25H,6H2,1H3/t7-,10+,11+,12-,13+,14-,15-,16+,17-,18-/m0/s1
SMILESCC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC=C(C=C3)[N+](=O)[O-])CO)O)O)O)O)O
Synonyms4-Nitrophenyl 2-O-(6-Deoxy-α-L-galactopyranosyl)-α-D-galactopyranoside;


INQUIRY

Scan the qr codeClose
the qr code