Cas:223920-67-0 ,
DMNPE-caged Luciferin,D-Luciferin 1-(4,5-dimethoxy-2-nitrophenyl)ethyl ester
C21H19N3O7S2 / 489.53
MFCD00467661
D-Luciferin 1-(4,5-dimethoxy-2- nitrophenyl) ethyl ester is a heterocyclic light-emitting compound and natural ligand for luciferase used to detect cell activity. It requires ATP for its reaction, emitting a greenish-yellow luminescence at a peak wavelenght of approximately 530 nm. DMNPE-caged lucifern crosses cell membranes easily.
D-Luciferin 1-(4,5-dimethoxy-2-nitrophenyl)ethyl ester is a chemiluminescent substrate specifically designed for luciferase enzymes. This nitrophenyl ester derivative of luciferin exhibits enhanced water solubility and improved stability compared to native D-luciferin. Upon enzymatic cleavage by luciferase, it generates a highly sensitive and stable luminescent signal, making it an ideal choice for various bioluminescence-based assays, including gene expression analysis, drug screening, and in vivo imaging. Its unique chemical structure allows for rapid and efficient cellular uptake, ensuring high sensitivity and low background noise in bioluminescent experiments.
CAS Number | 223920-67-0 |
Product Name | D-Luciferin 1-(4,5-dimethoxy-2-nitrophenyl) ethyl ester |
IUPAC Name | 1-(4,5-dimethoxy-2-nitrophenyl)ethyl (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate |
Molecular Formula | C21H19N3O7S2 |
Molecular Weight | 489.5 g/mol |
InChI | InChI=1S/C21H19N3O7S2/c1-10(12-7-16(29-2)17(30-3)8-15(12)24(27)28)31-21(26)14-9-32-19(23-14)20-22-13-5-4-11(25)6-18(13)33-20/h4-8,10,14,25H,9H2,1-3H3/t10?,14-/m1/s1 |
InChI Key | KQVRVPOUBLPROI-RMGLFMTASA-N |
SMILES | CC(C1=CC(=C(C=C1[N+](=O)[O-])OC)OC)OC(=O)C2CSC(=N2)C3=NC4=C(S3)C=C(C=C4)O |
Solubility | Soluble in DMSO |
Synonyms | D-Luciferin 1-(4,5-dimethoxy-2- nitrophenyl) ethyl ester; DMNPE |
Canonical SMILES | CC(C1=CC(=C(C=C1[N+](=O)[O-])OC)OC)OC(=O)C2CSC(=N2)C3=NC4=C(S3)C=C(C=C4)O |
Isomeric SMILES | CC(C1=CC(=C(C=C1[N+](=O)[O-])OC)OC)OC(=O)[C@H]2CS/C(=C\3/N=C4C=CC(=O)C=C4S3)/N2 |
Contact: Miss.Xing
Phone: 18310328607 , 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628