Welcome: Chemsynlab ,carbohydrate chemistry
Language: Chinese ∷  English

219138-02-0 , Caspase substrate,Z-Ile-Glu-Thr-Asp-AFC; Z-IETD-AFC

Cas:219138-02-0 ,
Caspase substrate,Z-Ile-Glu-Thr-Asp-AFC; Z-IETD-AFC
C37H42F3N5O13 / 821.75

Caspase substrate,Z-Ile-Glu-Thr-Asp-AFC; Z-IETD-AFC

Z-IETD-AFC is a fluorogenic substrate for caspase-8 and granzyme B. Upon enzymatic cleavage by caspase-8 or granzyme B, 7-amino-4-trifluoromethylcoumarin (AFC) is released and its fluorescence can be used to quantify caspase-8 or granzyme B activity. AFC displays excitation/emission maxima of 400/505 nm, respectively.

Z-IETD-AFC is a fluorogenic caspase-8/granzyme B substrate. This substrate is hydrlyzed by caspase 8 to generate highly fluorescent 7-amido-4-trifluoromethylcoumarin (AFC).

Caspase substrates are a class of pharmacological agents that regulate apoptosis. Caspases are proteases that cleave specific proteins in the cell, leading to apoptosis. Pro-apoptotic proteins activate caspases, while anti-apoptotic proteins inhibit them. Caspase substrates can be either pro-caspase or anti-caspase, depending on the desired effect. They may also be used to regulate caspases without affecting their activity. The caspase substrate is cleaved by caspases and releases a polypeptide fragment that triggers apoptosis in some cells, but not others. For example, the Hl-60 cell line is resistant to the pro-apoptotic effects of the substrate because it contains an anti-apoptotic protein called Bcl-2. In contrast, myocardial cells contain pro-apoptotic proteins and are sensitive to the pro-apoptotic effects of the substrate.

CAS Number219138-02-0
Product NameZ-Ile-Glu-Thr-Asp 7-amido-4-trifluoromethylcoumarin
IUPAC Name(4S)-5-[[(2S,3R)-1-[[(2S)-3-carboxy-1-oxo-1-[[2-oxo-4-(trifluoromethyl)chromen-7-yl]amino]propan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-4-[[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-oxopentanoic acid
Molecular FormulaC37H42F3N5O13
Molecular Weight821.75
InChIInChI=1S/C37H42F3N5O13/c1-4-18(2)30(45-36(56)57-17-20-8-6-5-7-9-20)34(54)42-24(12-13-27(47)48)32(52)44-31(19(3)46)35(55)43-25(16-28(49)50)33(53)41-21-10-11-22-23(37(38,39)40)15-29(51)58-26(22)14-21/h5-11,14-15,18-19,24-25,30-31,46H,4,12-13,16-17H2,1-3H3,(H,41,53)(H,42,54)(H,43,55)(H,44,52)(H,45,56)(H,47,48)(H,49,50)/t18-,19+,24-,25-,30-,31-/m0/s1
SMILESCCC(C)C(C(=O)NC(CCC(=O)O)C(=O)NC(C(C)O)C(=O)NC(CC(=O)O)C(=O)NC1=CC2=C(C=C1)C(=CC(=O)O2)C(F)(F)F)NC(=O)OCC3=CC=CC=C3


INQUIRY

Scan the qr codeClose
the qr code