Welcome: Chemsynlab ,carbohydrate chemistry
Language:
∷
∷
∷
189095-18-9 , 4-Nitrophenyl b-D-cellohexaoside
C42H65NO33 / 1111.95
4-Nitrophenyl b-D-cellohexaoside is a substrate for many enzymes and can be used to detect the presence of these enzymes in biological samples. It can also be used to detect the presence of bacteria, fungi, parasites, and viruses. 4-Nitrophenyl b-D-cellohexaoside is an excellent substrate for enzyme reactions that produce a chromogenic or fluorogenic product. This product is often conjugated with other compounds such as antibodies or antigens to form an immunoassay.
| CAS No | 189095-18-9 |
| Molecular Weight | 1,111.95 g/mol |
| Smiles | OCC1O[C@@H](O[C@H]2[C@H](O)C(O)[C@H](O[C@H]3[C@H](O)C(O)[C@H](O[C@H]4[C@H](O)C(O)[C@H](O[C@H]5[C@H](O)C(O)[C@H](O[C@H]6[C@H](O)C(O)[C@H](Oc7ccc(cc7)[N+](=O)[O-])OC6CO)OC5CO)OC4CO)OC3CO)OC2CO)C(O)[C@@H](O)[C@@H]1O |
Contact: Miss.Xing
Phone: 18310328607 , 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628
chemsynlab