14155-23-8, Methyl 4,6-O-benzylidene-b-D-glucopyranoside,
CAS:14155-23-8
C14H18O6 / 282.289
MFCD00184635
Methyl 4,6-O-benzylidene-b-D-glucopyranoside is a nitro derivative of methyl b-D-glucopyranoside. The anomeric proton and the nitro group are in the same plane and on opposite sides of the molecule. This compound has been shown to be both a receptor binding agent and a gelation agent. It is used to study biological membranes because it binds to phospholipids in the cell membrane, which alters its physical properties. Methyl 4,6-O-benzylidene-b-D-glucopyranoside is also known for its ability to form hydrogen bonds with water molecules. This is due to its cavity that can accommodate one water molecule per monomer unit. The crystal structure of this compound has been determined by x ray crystallography and shows that it forms dimers through hydrogen bonding between two molecules in each dimer.
CAS Number | 14155-23-8 |
Product Name | (4aR,6R,7R,8R,8aS)-6-Methoxy-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
IUPAC Name | (4aR,6R,7R,8R,8aS)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
Molecular Formula | C₁₄H₁₈O₆ |
Molecular Weight | 282.289 |
InChI | InChI=1S/C14H18O6/c1-17-14-11(16)10(15)12-9(19-14)7-18-13(20-12)8-5-3-2-4-6-8/h2-6,9-16H,7H2,1H3/t9-,10-,11-,12-,13?,14-/m1/s1 |
SMILES | COC1C(C(C2C(O1)COC(O2)C3=CC=CC=C3)O)O |
Synonyms | Methyl 4,6-O-(Phenylmethylene)-β-D-glucopyranoside; |
CAS No: 14155-23-8 MDL No: MFCD00184635 Chemical Formula: C14H18O6 Molecular Weight: 282.289 |
References: 1. Khan R, Patel G, Carbohydr. Res. 1990, Sep 19, 205, 211-23 |
Contact: Mr.Li
Phone: 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628