123228-39-7 , Heparin disaccharide IV-H
Cas:123228-39-7
C12H19NO10 / 337.28
MFCD00166787
Heparin disaccharide IV-H is a synthetic derivative of low molecular weight heparin (LMWH) composed of two units of glucuronic acid (GlcUA) and N-acetyl glucosamine (GlcNAc) connected through a 1,4 glycosidic bond. It was first synthesized in the early 2000s through a chemo-enzymatic approach and has since been studied for its potential use as an anticoagulant and anti-tumor agent.
| CAS Number | 123228-39-7 |
| Product Name | Heparin disaccharide IV-H |
| IUPAC Name | 2-(5-amino-1,2,4-trihydroxy-6-oxohexan-3-yl)oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
| Molecular Formula | C12H19NO10 |
| Molecular Weight | 337.28 g/mol |
| InChI | InChI=1S/C12H19NO10/c13-4(2-14)8(18)10(6(17)3-15)23-12-9(19)5(16)1-7(22-12)11(20)21/h1-2,4-6,8-10,12,15-19H,3,13H2,(H,20,21) |
| InChI Key | RSCSYLOUHOXZCJ-UHFFFAOYSA-N |
| SMILES | C1=C(OC(C(C1O)O)OC(C(CO)O)C(C(C=O)N)O)C(=O)O |
| Canonical SMILES | C1=C(OC(C(C1O)O)OC(C(CO)O)C(C(C=O)N)O)C(=O)O |
Contact: Mr.Li
Phone: 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628