Welcome: Chemsynlab ,carbohydrate chemistry
Language: Chinese ∷  English

114496-02-5 , Coelenterazine E

114496-02-5 , Coelenterazine E
Cas:114496-02-5
C28H23N3O3 / 449.50
MFCD13181838

Coelenterazine E

Coelenterazine E is a bioluminescent probe.

Coelenterazine e is a synthetic amide that binds to calcium and is used as a substrate in biochemical reactions. It has been shown that Coelenterazine e can be used as a substrate for luciferase enzymes, which catalyzes the oxidation of Coelenterazine e to produce light emission. Coelenterazine e is also used in luminescence reactions where it undergoes photochemical reactions when exposed to light. This chemical has been found to be expressed in tissues such as liver, kidney, brain, and heart. Coelenterazine e exhibits luminescence properties due to its ability to emit light after being activated by an external stimulus such as heat or light.

CAS Number114496-02-5
Product NameCoelenterazine e
IUPAC Name16-benzyl-13-[(4-hydroxyphenyl)methyl]-11,14,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),3,5,12,14,16-heptaene-5,12-diol
Molecular FormulaC28H23N3O3
Molecular Weight449.5 g/mol
InChIInChI=1S/C28H23N3O3/c32-20-9-6-18(7-10-20)15-24-28(34)31-25-13-8-19-16-21(33)11-12-22(19)26(25)29-23(27(31)30-24)14-17-4-2-1-3-5-17/h1-7,9-12,16,32-34H,8,13-15H2
InChI KeyLSSJELUXTIYYDZ-UHFFFAOYSA-N
SMILESC1CC2=C(C3=C1C=C(C=C3)O)N=C(C4=NC(=C(N24)O)CC5=CC=C(C=C5)O)CC6=CC=CC=C6
SolubilitySoluble in DMSO
SynonymsC-7020; C7020; C 7020; E-Coelenterazine; E Coelenterazine; Coelenterazine-E; CoelenterazineE; Coelenterazine E
Canonical SMILESC1CC2=C(C3=C1C=C(C=C3)O)NC(=C4N2C(=O)C(=N4)CC5=CC=C(C=C5)O)CC6=CC=CC=C6
Isomeric SMILESC1CC2=C(C3=C1C=C(C=C3)O)NC(=C4N2C(=O)C(=N4)CC5=CC=C(C=C5)O)CC6=CC=CC=C6


INQUIRY

Scan the qr codeClose
the qr code