Cas:114162-64-0 ,
5-Bromo-4-chloro-3-indolyl b-D-glucuronide cyclohexylammonium salt monohydrate,X-Glucuronide;
X-GlcA; X-beta-D-glucuronide cyclohexylammonium salt; X-beta-D-GlcA CHX salt
C14H13BrClNO7·C6H13N·H2O / 539.80
MFCD00058543
X-GlcA; X-beta-D-glucuronide cyclohexylammonium salt; X-beta-D-GlcA CHX salt
Chromogenic substrate for β-glucuronidase that is converted by the enzyme into an intense blue prepicitate. Used for the detection of the Gus gene in bacterial colonies.
| CAS Number | 114162-64-0 |
| Product Name | Cyclohexanamine (2S,3S,4S,5R,6S)-6-((5-bromo-4-chloro-1H-indol-3-yl)oxy)-3,4,5-trihydroxytetrahydro-2H-pyran-2-carboxylate |
| IUPAC Name | 6-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylate;cyclohexylazanium |
| Molecular Formula | C₂₀H₂₆BrClN₂O₇ |
| Molecular Weight | 521.8 g/mol |
| InChI | InChI=1S/C14H13BrClNO7.C6H13N/c15-4-1-2-5-7(8(4)16)6(3-17-5)23-14-11(20)9(18)10(19)12(24-14)13(21)22;7-6-4-2-1-3-5-6/h1-3,9-12,14,17-20H,(H,21,22);6H,1-5,7H2 |
| InChI Key | JXCKZXHCJOVIAV-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)[NH3+].C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)C(=O)[O-])O)O)O)Cl)Br |
| Synonyms | 5-bromo-4-chloro-3-indolyl-beta-D-glucuronide cyclohexylammonium salt, 5-bromo-4-chloro-3-indolylglucuronide, BCI-3 Glud |
| Canonical SMILES | C1CCC(CC1)[NH3+].C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)C(=O)[O-])O)O)O)Cl)Br |
| Isomeric SMILES | C1CCC(CC1)N.C1=CC(=C(C2=C1NC=C2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O)Cl)Br |
Contact: Mr.Li
Phone: 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628