106488-05-5, 4-Methylumbelliferyl-alpha-L-rhamnopyranoside,
CAS: 106488-05-5
C16H18O7 / 322.32
MFCD00171591
4-Methylumbelliferyl-alpha-L-rhamnopyranoside
4-Methylumbelliferyl-alpha-L-rhamnopyranoside is a fluorescent substrate of the enzyme ribonuclease, which is used in diagnostic applications such as the detection of bacterial growth or in food testing. It can be used to detect DNA or RNA by binding to the nucleic acid and emitting light when excited with a specific wavelength of light. 4-Methylumbelliferyl-alpha-L-rhamnopyranoside is also a strong ligand for certain metal ions, such as copper(II), that can be used for environmental testing.
CAS Number | 106488-05-5 |
Product Name | 4-Methylumbelliferyl alpha-L-rhamnopyranoside |
IUPAC Name | 4-methyl-7-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-2-one |
Molecular Formula | C16H18O7 |
Molecular Weight | 322.32 g/mol |
InChI | InChI=1S/C16H18O7/c1-7-5-12(17)23-11-6-9(3-4-10(7)11)22-16-15(20)14(19)13(18)8(2)21-16/h3-6,8,13-16,18-20H,1-2H3/t8-,13-,14+,15+,16-/m0/s1 |
InChI Key | CQKHENXHLAUMBH-JKNOJPNLSA-N |
SMILES | CC1C(C(C(C(O1)OC2=CC3=C(C=C2)C(=CC(=O)O3)C)O)O)O |
Canonical SMILES | CC1C(C(C(C(O1)OC2=CC3=C(C=C2)C(=CC(=O)O3)C)O)O)O |
Isomeric SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=CC3=C(C=C2)C(=CC(=O)O3)C)O)O)O |
Contact: Miss.Xing
Phone: 18310328607 , 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628